heyimwormy65 heyimwormy65
  • 20-06-2019
  • Chemistry
contestada

Write the complete balanced equation for the reaction between lead (IV) oxide (PbO2) and water (H2O).

Respuesta :

NeilIceland
NeilIceland NeilIceland
  • 20-06-2019
PbO2+2H2O=Pb(OH)2+O2(gas)
Answer Link

Otras preguntas

If a physician doubles office space and staff, and average costs _______, then _______ of scale are present
The volume of one mole of a substance is 22.4 L at STP for all ____. A. Gases B. Liquids C. Solids D. Compounds
Briefly describe the cellular events responsible for the refractory period (hint: discuss the mechanism of repolarization).
What did the wilmot proviso, introduced in congress in 1846, propose to do?
historical circumstances and geographic factors that led to the creation of Hammurabi’s Code.
For the data in the table does y vary directly with x? X=16,32,48-Y=4,16,36
The trading of cloth, guns, and liquor served as what section of the Triangular Trade Route?
1. How does bacteria become resistant to medicines?2. How does mutation increase chances for survival?
What is the purpose of schedule c in taxes
Mis hermanos ____ conducir, pero yo no ____. conocen, conozco saben, sé conoce, sabe saben, conozco —¿____ ustedes dónde está el estadio? —no, no lo ____. conoc